β-damascenone
| Β-damascenone | |
|---|---|
 | |
 | |
| Caratteristiche generali | |
| Formula bruta o molecolare | C13H18O |
| Massa molecolare (u) | 190,28 |
| Numero CAS | |
| Numero EINECS | 245-844-2 |
| PubChem | 5366074 |
| SMILES | CC=CC(=O)C1=C(C=CCC1(C)C)C |
| Indicazioni di sicurezza | |
Il β-damascenone è la sostanza che contribuisce maggiormente al profumo di rosa.
Deriva dalla degradazione dei carotenoidi.[1]
Note
[modifica | modifica wikitesto]- ^ (EN) Sachihiko Isoe, Shigeo Katsumura, Takeo Sakan, The Synthesis of Damascenone and beta-Damascone and the possible mechanism of their formation from carotenoids, in Helvetica Chimica Acta, vol. 56, n. 5, 1973, pp. 1514–1516, DOI:10.1002/hlca.19730560508.
Collegamenti esterni
[modifica | modifica wikitesto]- β-damascenone, Molecule of the Week, March 14, 2005 [1] Archiviato il 12 marzo 2005 in Internet Archive.
